C6H18N2Si2 — CID 123216940
(2,5-dimethyl-4-silylpiperazin-1-yl)silane (PubChem CID 123216940) has the molecular formula C6H18N2Si2 and a molecular weight of 174.40 g/mol. Its IUPAC name is (2,5-dimethyl-4-silylpiperazin-1-yl)silane.
| Compound Name | (2,5-dimethyl-4-silylpiperazin-1-yl)silane |
|---|---|
| PubChem CID | 123216940 |
| Molecular Formula | C6H18N2Si2 |
| Molecular Weight | 174.40 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | (2,5-dimethyl-4-silylpiperazin-1-yl)silane |
| SMILES | CC1CN([SiH3])C(C)CN1[SiH3] |
| InChI | InChI=1S/C6H18N2Si2/c1-5-3-8(10)6(2)4-7(5)9/h5-6H,3-4H2,1-2,9-10H3 |
| InChIKey | PMKWGJCOUWCNHS-UHFFFAOYSA-N |
| XLogP | -2.06 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.40 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|