C8H22N2Si2 — CID 125480033
[(2R,3S,5S,6R)-2,3,5,6-tetramethyl-4-silylpiperazin-1-yl]silane (PubChem CID 125480033) has the molecular formula C8H22N2Si2 and a molecular weight of 202.45 g/mol. Its IUPAC name is [(2R,3S,5S,6R)-2,3,5,6-tetramethyl-4-silylpiperazin-1-yl]silane.
| Compound Name | [(2R,3S,5S,6R)-2,3,5,6-tetramethyl-4-silylpiperazin-1-yl]silane |
|---|---|
| PubChem CID | 125480033 |
| Molecular Formula | C8H22N2Si2 |
| Molecular Weight | 202.45 g/mol |
| Exact Mass | 202.13 |
| IUPAC Name | [(2R,3S,5S,6R)-2,3,5,6-tetramethyl-4-silylpiperazin-1-yl]silane |
| SMILES | C[C@@H]1[C@H](C)N([SiH3])[C@@H](C)[C@@H](C)N1[SiH3] |
| InChI | InChI=1S/C8H22N2Si2/c1-5-6(2)10(12)8(4)7(3)9(5)11/h5-8H,1-4,11-12H3/t5-,6+,7-,8+ |
| InChIKey | HRTDAJGUCXQWBA-KVFPUHGPSA-N |
| XLogP | -1.28 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.45 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|