C9H21NO — CID 143986046
ethane;(2R)-2,3,4-trimethylmorpholine (PubChem CID 143986046) has the molecular formula C9H21NO and a molecular weight of 159.27 g/mol. Its IUPAC name is ethane;(2R)-2,3,4-trimethylmorpholine.
| Compound Name | ethane;(2R)-2,3,4-trimethylmorpholine |
|---|---|
| PubChem CID | 143986046 |
| Molecular Formula | C9H21NO |
| Molecular Weight | 159.27 g/mol |
| Exact Mass | 159.16 |
| IUPAC Name | ethane;(2R)-2,3,4-trimethylmorpholine |
| SMILES | CC.CC1[C@@H](C)OCCN1C |
| InChI | InChI=1S/C7H15NO.C2H6/c1-6-7(2)9-5-4-8(6)3;1-2/h6-7H,4-5H2,1-3H3;1-2H3/t6?,7-;/m1./s1 |
| InChIKey | PUTPSVBRGXGXSI-SGMQTFONSA-N |
| XLogP | 1.75 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.27 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |