C7H15NO2 — CID 155290860
[(2S,3S)-2,4-dimethylmorpholin-3-yl]methanol (PubChem CID 155290860) has the molecular formula C7H15NO2 and a molecular weight of 145.20 g/mol. Its IUPAC name is [(2S,3S)-2,4-dimethylmorpholin-3-yl]methanol.
| Compound Name | [(2S,3S)-2,4-dimethylmorpholin-3-yl]methanol |
|---|---|
| PubChem CID | 155290860 |
| Molecular Formula | C7H15NO2 |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.11 |
| IUPAC Name | [(2S,3S)-2,4-dimethylmorpholin-3-yl]methanol |
| SMILES | C[C@@H]1OCCN(C)[C@H]1CO |
| InChI | InChI=1S/C7H15NO2/c1-6-7(5-9)8(2)3-4-10-6/h6-7,9H,3-5H2,1-2H3/t6-,7-/m0/s1 |
| InChIKey | HFDUNPUCOXLFJE-BQBZGAKWSA-N |
| XLogP | -0.30 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |