About (2R,3R)-3-ethyl-2,4-dimethylmorpholine
(2R,3R)-3-ethyl-2,4-dimethylmorpholine (PubChem CID 118134338) has the molecular formula C8H17NO
and a molecular weight of 143.23 g/mol. Its IUPAC name is (2R,3R)-3-ethyl-2,4-dimethylmorpholine.
Molecular Properties
| Compound Name | (2R,3R)-3-ethyl-2,4-dimethylmorpholine |
| PubChem CID | 118134338 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | (2R,3R)-3-ethyl-2,4-dimethylmorpholine |
| SMILES | CC[C@@H]1[C@@H](C)OCCN1C |
| InChI | InChI=1S/C8H17NO/c1-4-8-7(2)10-6-5-9(8)3/h7-8H,4-6H2,1-3H3/t7-,8-/m1/s1 |
| InChIKey | SYGQUAVEBPJLKX-HTQZYQBOSA-N |
| XLogP | 1.12 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R,3R)-3-ethyl-2,4-dimethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3R)-3-ethyl-2,4-dimethylmorpholine?
The IUPAC name of (2R,3R)-3-ethyl-2,4-dimethylmorpholine (CID 118134338) is (2R,3R)-3-ethyl-2,4-dimethylmorpholine.
What is the SMILES notation for (2R,3R)-3-ethyl-2,4-dimethylmorpholine?
The canonical SMILES for (2R,3R)-3-ethyl-2,4-dimethylmorpholine is CC[C@@H]1[C@@H](C)OCCN1C.
What is the InChIKey of (2R,3R)-3-ethyl-2,4-dimethylmorpholine?
The InChIKey is SYGQUAVEBPJLKX-HTQZYQBOSA-N. The full InChI is InChI=1S/C8H17NO/c1-4-8-7(2)10-6-5-9(8)3/h7-8H,4-6H2,1-3H3/t7-,8-/m1/s1.
What are the key properties of (2R,3R)-3-ethyl-2,4-dimethylmorpholine?
(2R,3R)-3-ethyl-2,4-dimethylmorpholine has a molecular weight of 143.23 g/mol, XLogP of 1.12, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3R)-3-ethyl-2,4-dimethylmorpholine is sourced from PubChem (CID 118134338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).