About (1-methylpyrrolidin-3-id-2-yl)methanol;rubidium(1+)
(1-methylpyrrolidin-3-id-2-yl)methanol;rubidium(1+) (PubChem CID 59763316) has the molecular formula C6H12NORb
and a molecular weight of 199.64 g/mol. Its IUPAC name is (1-methylpyrrolidin-3-id-2-yl)methanol;rubidium(1+).
Molecular Properties
| Compound Name | (1-methylpyrrolidin-3-id-2-yl)methanol;rubidium(1+) |
| PubChem CID | 59763316 |
| Molecular Formula | C6H12NORb |
| Molecular Weight | 199.64 g/mol |
| Exact Mass | 199.00 |
| IUPAC Name | (1-methylpyrrolidin-3-id-2-yl)methanol;rubidium(1+) |
| SMILES | CN1CC[CH-]C1CO.[Rb+] |
| InChI | InChI=1S/C6H12NO.Rb/c1-7-4-2-3-6(7)5-8;/h3,6,8H,2,4-5H2,1H3;/q-1;+1 |
| InChIKey | PXNJBEAPCMPMRT-UHFFFAOYSA-N |
| XLogP | -3.11 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.64 |
| LogP ≤ 5 | -3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze (1-methylpyrrolidin-3-id-2-yl)methanol;rubidium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylpyrrolidin-3-id-2-yl)methanol;rubidium(1+)?
The IUPAC name of (1-methylpyrrolidin-3-id-2-yl)methanol;rubidium(1+) (CID 59763316) is (1-methylpyrrolidin-3-id-2-yl)methanol;rubidium(1+).
What is the SMILES notation for (1-methylpyrrolidin-3-id-2-yl)methanol;rubidium(1+)?
The canonical SMILES for (1-methylpyrrolidin-3-id-2-yl)methanol;rubidium(1+) is CN1CC[CH-]C1CO.[Rb+].
What is the InChIKey of (1-methylpyrrolidin-3-id-2-yl)methanol;rubidium(1+)?
The InChIKey is PXNJBEAPCMPMRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12NO.Rb/c1-7-4-2-3-6(7)5-8;/h3,6,8H,2,4-5H2,1H3;/q-1;+1.
What are the key properties of (1-methylpyrrolidin-3-id-2-yl)methanol;rubidium(1+)?
(1-methylpyrrolidin-3-id-2-yl)methanol;rubidium(1+) has a molecular weight of 199.64 g/mol, XLogP of -3.11, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylpyrrolidin-3-id-2-yl)methanol;rubidium(1+) is sourced from PubChem (CID 59763316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).