About ethane;5-methyl-2-oxa-5-azabicyclo[4.1.0]heptane;sulfane
ethane;5-methyl-2-oxa-5-azabicyclo[4.1.0]heptane;sulfane (PubChem CID 153330745) has the molecular formula C8H19NOS
and a molecular weight of 177.31 g/mol. Its IUPAC name is ethane;5-methyl-2-oxa-5-azabicyclo[4.1.0]heptane;sulfane.
Molecular Properties
| Compound Name | ethane;5-methyl-2-oxa-5-azabicyclo[4.1.0]heptane;sulfane |
| PubChem CID | 153330745 |
| Molecular Formula | C8H19NOS |
| Molecular Weight | 177.31 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | ethane;5-methyl-2-oxa-5-azabicyclo[4.1.0]heptane;sulfane |
| SMILES | CC.CN1CCOC2CC21.S |
| InChI | InChI=1S/C6H11NO.C2H6.H2S/c1-7-2-3-8-6-4-5(6)7;1-2;/h5-6H,2-4H2,1H3;1-2H3;1H2 |
| InChIKey | KRFKFCRFEVIQFW-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.31 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;5-methyl-2-oxa-5-azabicyclo[4.1.0]heptane;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-methyl-2-oxa-5-azabicyclo[4.1.0]heptane;sulfane?
The IUPAC name of ethane;5-methyl-2-oxa-5-azabicyclo[4.1.0]heptane;sulfane (CID 153330745) is ethane;5-methyl-2-oxa-5-azabicyclo[4.1.0]heptane;sulfane.
What is the SMILES notation for ethane;5-methyl-2-oxa-5-azabicyclo[4.1.0]heptane;sulfane?
The canonical SMILES for ethane;5-methyl-2-oxa-5-azabicyclo[4.1.0]heptane;sulfane is CC.CN1CCOC2CC21.S.
What is the InChIKey of ethane;5-methyl-2-oxa-5-azabicyclo[4.1.0]heptane;sulfane?
The InChIKey is KRFKFCRFEVIQFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO.C2H6.H2S/c1-7-2-3-8-6-4-5(6)7;1-2;/h5-6H,2-4H2,1H3;1-2H3;1H2.
What are the key properties of ethane;5-methyl-2-oxa-5-azabicyclo[4.1.0]heptane;sulfane?
ethane;5-methyl-2-oxa-5-azabicyclo[4.1.0]heptane;sulfane has a molecular weight of 177.31 g/mol, XLogP of 1.23, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-methyl-2-oxa-5-azabicyclo[4.1.0]heptane;sulfane is sourced from PubChem (CID 153330745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).