C15H29N3O — CID 129446177
(4aR,7aR)-4-methyl-6-(3-piperidin-1-ylpropyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine (PubChem CID 129446177) has the molecular formula C15H29N3O and a molecular weight of 267.42 g/mol. Its IUPAC name is (4aR,7aR)-4-methyl-6-(3-piperidin-1-ylpropyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine.
| Compound Name | (4aR,7aR)-4-methyl-6-(3-piperidin-1-ylpropyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine |
|---|---|
| PubChem CID | 129446177 |
| Molecular Formula | C15H29N3O |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.23 |
| IUPAC Name | (4aR,7aR)-4-methyl-6-(3-piperidin-1-ylpropyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine |
| SMILES | CN1CCO[C@@H]2CN(CCCN3CCCCC3)C[C@H]21 |
| InChI | InChI=1S/C15H29N3O/c1-16-10-11-19-15-13-18(12-14(15)16)9-5-8-17-6-3-2-4-7-17/h14-15H,2-13H2,1H3/t14-,15-/m1/s1 |
| InChIKey | OAMIZOBROSSKDV-HUUCEWRRSA-N |
| XLogP | 0.88 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |