C17H26N2O3S — CID 129446345
(4aS,7aS)-4-methyl-6-[3-(3-methylphenyl)sulfonylpropyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine (PubChem CID 129446345) has the molecular formula C17H26N2O3S and a molecular weight of 338.47 g/mol. Its IUPAC name is (4aS,7aS)-4-methyl-6-[3-(3-methylphenyl)sulfonylpropyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine.
| Compound Name | (4aS,7aS)-4-methyl-6-[3-(3-methylphenyl)sulfonylpropyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine |
|---|---|
| PubChem CID | 129446345 |
| Molecular Formula | C17H26N2O3S |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | (4aS,7aS)-4-methyl-6-[3-(3-methylphenyl)sulfonylpropyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine |
| SMILES | Cc1cccc(S(=O)(=O)CCCN2C[C@@H]3OCCN(C)[C@H]3C2)c1 |
| InChI | InChI=1S/C17H26N2O3S/c1-14-5-3-6-15(11-14)23(20,21)10-4-7-19-12-16-17(13-19)22-9-8-18(16)2/h3,5-6,11,16-17H,4,7-10,12-13H2,1-2H3/t16-,17-/m0/s1 |
| InChIKey | SVNKALPGGGVACP-IRXDYDNUSA-N |
| XLogP | 1.17 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |