C17H25N3O4S — CID 124810278
2-[(4aS,7aR)-6-(3-methylphenyl)sulfonyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-4-yl]-N,N-dimethylacetamide (PubChem CID 124810278) has the molecular formula C17H25N3O4S and a molecular weight of 367.47 g/mol. Its IUPAC name is 2-[(4aS,7aR)-6-(3-methylphenyl)sulfonyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-4-yl]-N,N-dimethylacetamide.
| Compound Name | 2-[(4aS,7aR)-6-(3-methylphenyl)sulfonyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-4-yl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 124810278 |
| Molecular Formula | C17H25N3O4S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 2-[(4aS,7aR)-6-(3-methylphenyl)sulfonyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-4-yl]-N,N-dimethylacetamide |
| SMILES | Cc1cccc(S(=O)(=O)N2C[C@H]3OCCN(CC(=O)N(C)C)[C@H]3C2)c1 |
| InChI | InChI=1S/C17H25N3O4S/c1-13-5-4-6-14(9-13)25(22,23)20-10-15-16(11-20)24-8-7-19(15)12-17(21)18(2)3/h4-6,9,15-16H,7-8,10-12H2,1-3H3/t15-,16+/m0/s1 |
| InChIKey | VDMFYGYPDOKGLB-JKSUJKDBSA-N |
| XLogP | 0.16 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |