C13H17NO5S2 — CID 110290131
4-(3-methylphenyl)sulfonyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]oxazine 6,6-dioxide (PubChem CID 110290131) has the molecular formula C13H17NO5S2 and a molecular weight of 331.42 g/mol. Its IUPAC name is 4-(3-methylphenyl)sulfonyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]oxazine 6,6-dioxide.
| Compound Name | 4-(3-methylphenyl)sulfonyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]oxazine 6,6-dioxide |
|---|---|
| PubChem CID | 110290131 |
| Molecular Formula | C13H17NO5S2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | 4-(3-methylphenyl)sulfonyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]oxazine 6,6-dioxide |
| SMILES | Cc1cccc(S(=O)(=O)N2CCOC3CS(=O)(=O)CC32)c1 |
| InChI | InChI=1S/C13H17NO5S2/c1-10-3-2-4-11(7-10)21(17,18)14-5-6-19-13-9-20(15,16)8-12(13)14/h2-4,7,12-13H,5-6,8-9H2,1H3 |
| InChIKey | YFEKYLHQQZZQGU-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |