C14H20N2O5S2 — CID 70754566
(4aR,7aS)-4-(3-methoxyphenyl)sulfonyl-1-methyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide (PubChem CID 70754566) has the molecular formula C14H20N2O5S2 and a molecular weight of 360.46 g/mol. Its IUPAC name is (4aR,7aS)-4-(3-methoxyphenyl)sulfonyl-1-methyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide.
| Compound Name | (4aR,7aS)-4-(3-methoxyphenyl)sulfonyl-1-methyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide |
|---|---|
| PubChem CID | 70754566 |
| Molecular Formula | C14H20N2O5S2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | (4aR,7aS)-4-(3-methoxyphenyl)sulfonyl-1-methyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide |
| SMILES | COc1cccc(S(=O)(=O)N2CCN(C)[C@@H]3CS(=O)(=O)C[C@@H]32)c1 |
| InChI | InChI=1S/C14H20N2O5S2/c1-15-6-7-16(14-10-22(17,18)9-13(14)15)23(19,20)12-5-3-4-11(8-12)21-2/h3-5,8,13-14H,6-7,9-10H2,1-2H3/t13-,14+/m1/s1 |
| InChIKey | XTOHUILGQOZAMR-KGLIPLIRSA-N |
| XLogP | -0.20 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |