C15H20N2O6S2 — CID 110629008
3-(6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]oxazine-4-carbonyl)-N,N-dimethylbenzenesulfonamide (PubChem CID 110629008) has the molecular formula C15H20N2O6S2 and a molecular weight of 388.47 g/mol. Its IUPAC name is 3-(6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]oxazine-4-carbonyl)-N,N-dimethylbenzenesulfonamide.
| Compound Name | 3-(6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]oxazine-4-carbonyl)-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 110629008 |
| Molecular Formula | C15H20N2O6S2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | 3-(6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]oxazine-4-carbonyl)-N,N-dimethylbenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1cccc(C(=O)N2CCOC3CS(=O)(=O)CC32)c1 |
| InChI | InChI=1S/C15H20N2O6S2/c1-16(2)25(21,22)12-5-3-4-11(8-12)15(18)17-6-7-23-14-10-24(19,20)9-13(14)17/h3-5,8,13-14H,6-7,9-10H2,1-2H3 |
| InChIKey | ARQNXKOCAJWKNA-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |