C17H20N2O5S — CID 110308303
1-[4-(6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]oxazine-4-carbonyl)phenyl]pyrrolidin-2-one (PubChem CID 110308303) has the molecular formula C17H20N2O5S and a molecular weight of 364.42 g/mol. Its IUPAC name is 1-[4-(6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]oxazine-4-carbonyl)phenyl]pyrrolidin-2-one.
| Compound Name | 1-[4-(6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]oxazine-4-carbonyl)phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 110308303 |
| Molecular Formula | C17H20N2O5S |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 1-[4-(6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]oxazine-4-carbonyl)phenyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1c1ccc(C(=O)N2CCOC3CS(=O)(=O)CC32)cc1 |
| InChI | InChI=1S/C17H20N2O5S/c20-16-2-1-7-18(16)13-5-3-12(4-6-13)17(21)19-8-9-24-15-11-25(22,23)10-14(15)19/h3-6,14-15H,1-2,7-11H2 |
| InChIKey | MQXDYNGWILGKAJ-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |