C18H22N2O5S — CID 110312388
2-[4-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine-4-carbonyl)phenyl]-1,1-dioxo-1,2-thiazolidin-3-one (PubChem CID 110312388) has the molecular formula C18H22N2O5S and a molecular weight of 378.45 g/mol. Its IUPAC name is 2-[4-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine-4-carbonyl)phenyl]-1,1-dioxo-1,2-thiazolidin-3-one.
| Compound Name | 2-[4-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine-4-carbonyl)phenyl]-1,1-dioxo-1,2-thiazolidin-3-one |
|---|---|
| PubChem CID | 110312388 |
| Molecular Formula | C18H22N2O5S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 2-[4-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine-4-carbonyl)phenyl]-1,1-dioxo-1,2-thiazolidin-3-one |
| SMILES | O=C(c1ccc(N2C(=O)CCS2(=O)=O)cc1)N1CCOC2CCCCC21 |
| InChI | InChI=1S/C18H22N2O5S/c21-17-9-12-26(23,24)20(17)14-7-5-13(6-8-14)18(22)19-10-11-25-16-4-2-1-3-15(16)19/h5-8,15-16H,1-4,9-12H2 |
| InChIKey | RVPZDHVQHVWHMG-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |