C14H19NO5S2 — CID 110290104
4-(3,4-dimethylphenyl)sulfonyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]oxazine 6,6-dioxide (PubChem CID 110290104) has the molecular formula C14H19NO5S2 and a molecular weight of 345.44 g/mol. Its IUPAC name is 4-(3,4-dimethylphenyl)sulfonyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]oxazine 6,6-dioxide.
| Compound Name | 4-(3,4-dimethylphenyl)sulfonyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]oxazine 6,6-dioxide |
|---|---|
| PubChem CID | 110290104 |
| Molecular Formula | C14H19NO5S2 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | 4-(3,4-dimethylphenyl)sulfonyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]oxazine 6,6-dioxide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCOC3CS(=O)(=O)CC32)cc1C |
| InChI | InChI=1S/C14H19NO5S2/c1-10-3-4-12(7-11(10)2)22(18,19)15-5-6-20-14-9-21(16,17)8-13(14)15/h3-4,7,13-14H,5-6,8-9H2,1-2H3 |
| InChIKey | PDTUHQRRWIOVGN-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |