C11H14ClNO3S — CID 110740254
3-(3-chloro-4-methylphenyl)sulfonyl-2-methyl-1,3-oxazolidine (PubChem CID 110740254) has the molecular formula C11H14ClNO3S and a molecular weight of 275.76 g/mol. Its IUPAC name is 3-(3-chloro-4-methylphenyl)sulfonyl-2-methyl-1,3-oxazolidine.
| Compound Name | 3-(3-chloro-4-methylphenyl)sulfonyl-2-methyl-1,3-oxazolidine |
|---|---|
| PubChem CID | 110740254 |
| Molecular Formula | C11H14ClNO3S |
| Molecular Weight | 275.76 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | 3-(3-chloro-4-methylphenyl)sulfonyl-2-methyl-1,3-oxazolidine |
| SMILES | Cc1ccc(S(=O)(=O)N2CCOC2C)cc1Cl |
| InChI | InChI=1S/C11H14ClNO3S/c1-8-3-4-10(7-11(8)12)17(14,15)13-5-6-16-9(13)2/h3-4,7,9H,5-6H2,1-2H3 |
| InChIKey | ILEAOWKQNJRXKH-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.76 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |