C12H17NO3S — CID 110739862
2-methyl-3-(4-methylphenyl)sulfonyl-1,3-oxazinane (PubChem CID 110739862) has the molecular formula C12H17NO3S and a molecular weight of 255.34 g/mol. Its IUPAC name is 2-methyl-3-(4-methylphenyl)sulfonyl-1,3-oxazinane.
| Compound Name | 2-methyl-3-(4-methylphenyl)sulfonyl-1,3-oxazinane |
|---|---|
| PubChem CID | 110739862 |
| Molecular Formula | C12H17NO3S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 2-methyl-3-(4-methylphenyl)sulfonyl-1,3-oxazinane |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCOC2C)cc1 |
| InChI | InChI=1S/C12H17NO3S/c1-10-4-6-12(7-5-10)17(14,15)13-8-3-9-16-11(13)2/h4-7,11H,3,8-9H2,1-2H3 |
| InChIKey | GSLUPAUACBHJQY-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |