C12H15NO3S — CID 134965346
2-ethenyl-3-(4-methylphenyl)sulfonyl-1,3-oxazolidine (PubChem CID 134965346) has the molecular formula C12H15NO3S and a molecular weight of 253.32 g/mol. Its IUPAC name is 2-ethenyl-3-(4-methylphenyl)sulfonyl-1,3-oxazolidine.
| Compound Name | 2-ethenyl-3-(4-methylphenyl)sulfonyl-1,3-oxazolidine |
|---|---|
| PubChem CID | 134965346 |
| Molecular Formula | C12H15NO3S |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | 2-ethenyl-3-(4-methylphenyl)sulfonyl-1,3-oxazolidine |
| SMILES | C=CC1OCCN1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C12H15NO3S/c1-3-12-13(8-9-16-12)17(14,15)11-6-4-10(2)5-7-11/h3-7,12H,1,8-9H2,2H3 |
| InChIKey | RGGOIXCQQXPTIT-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|