C22H39NO3SSn — CID 11156581
tributyl-[3-(4-methylphenyl)sulfonyl-1,3-oxazolidin-2-yl]stannane (PubChem CID 11156581) has the molecular formula C22H39NO3SSn and a molecular weight of 516.34 g/mol. Its IUPAC name is tributyl-[3-(4-methylphenyl)sulfonyl-1,3-oxazolidin-2-yl]stannane.
| Compound Name | tributyl-[3-(4-methylphenyl)sulfonyl-1,3-oxazolidin-2-yl]stannane |
|---|---|
| PubChem CID | 11156581 |
| Molecular Formula | C22H39NO3SSn |
| Molecular Weight | 516.34 g/mol |
| Exact Mass | 517.17 |
| IUPAC Name | tributyl-[3-(4-methylphenyl)sulfonyl-1,3-oxazolidin-2-yl]stannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)C1OCCN1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C10H12NO3S.3C4H9.Sn/c1-9-2-4-10(5-3-9)15(12,13)11-6-7-14-8-11;3*1-3-4-2;/h2-5,8H,6-7H2,1H3;3*1,3-4H2,2H3; |
| InChIKey | NZPLYTYTYALRLU-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.34 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |