C23H40O2SSn — CID 134881012
tributyl-[3-(4-methylphenyl)sulfonylcyclobutyl]stannane (PubChem CID 134881012) has the molecular formula C23H40O2SSn and a molecular weight of 499.35 g/mol. Its IUPAC name is tributyl-[3-(4-methylphenyl)sulfonylcyclobutyl]stannane.
| Compound Name | tributyl-[3-(4-methylphenyl)sulfonylcyclobutyl]stannane |
|---|---|
| PubChem CID | 134881012 |
| Molecular Formula | C23H40O2SSn |
| Molecular Weight | 499.35 g/mol |
| Exact Mass | 500.18 |
| IUPAC Name | tributyl-[3-(4-methylphenyl)sulfonylcyclobutyl]stannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)C1CC(S(=O)(=O)c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C11H13O2S.3C4H9.Sn/c1-9-5-7-11(8-6-9)14(12,13)10-3-2-4-10;3*1-3-4-2;/h2,5-8,10H,3-4H2,1H3;3*1,3-4H2,2H3; |
| InChIKey | PJOUEODBJKGVSW-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.35 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |