C11H15NO2S — CID 99999683
[(1R,2S)-2-(4-methylphenyl)sulfonylcyclopropyl]methanamine (PubChem CID 99999683) has the molecular formula C11H15NO2S and a molecular weight of 225.31 g/mol. Its IUPAC name is [(1R,2S)-2-(4-methylphenyl)sulfonylcyclopropyl]methanamine.
| Compound Name | [(1R,2S)-2-(4-methylphenyl)sulfonylcyclopropyl]methanamine |
|---|---|
| PubChem CID | 99999683 |
| Molecular Formula | C11H15NO2S |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | [(1R,2S)-2-(4-methylphenyl)sulfonylcyclopropyl]methanamine |
| SMILES | Cc1ccc(S(=O)(=O)[C@H]2C[C@@H]2CN)cc1 |
| InChI | InChI=1S/C11H15NO2S/c1-8-2-4-10(5-3-8)15(13,14)11-6-9(11)7-12/h2-5,9,11H,6-7,12H2,1H3/t9-,11+/m1/s1 |
| InChIKey | HIAPVZWFYRGYFA-KOLCDFICSA-N |
| XLogP | 1.12 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |