C11H12O3S — CID 89149050
cis-(1S,2R)-2-(4-methylphenyl)sulfonylcyclopropane-1-carbaldehyde (PubChem CID 89149050) has the molecular formula C11H12O3S and a molecular weight of 224.28 g/mol. Its IUPAC name is cis-(1S,2R)-2-(4-methylphenyl)sulfonylcyclopropane-1-carbaldehyde.
| Compound Name | cis-(1S,2R)-2-(4-methylphenyl)sulfonylcyclopropane-1-carbaldehyde |
|---|---|
| PubChem CID | 89149050 |
| Molecular Formula | C11H12O3S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | cis-(1S,2R)-2-(4-methylphenyl)sulfonylcyclopropane-1-carbaldehyde |
| SMILES | Cc1ccc(S(=O)(=O)[C@@H]2C[C@H]2C=O)cc1 |
| InChI | InChI=1S/C11H12O3S/c1-8-2-4-10(5-3-8)15(13,14)11-6-9(11)7-12/h2-5,7,9,11H,6H2,1H3/t9-,11+/m0/s1 |
| InChIKey | ZOKJHZWUXBBWLS-GXSJLCMTSA-N |
| XLogP | 1.36 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|