C14H20O3S — CID 15316045
(2S,3R)-2-(4-methylphenyl)sulfonyl-3-pentyloxirane (PubChem CID 15316045) has the molecular formula C14H20O3S and a molecular weight of 268.38 g/mol. Its IUPAC name is (2S,3R)-2-(4-methylphenyl)sulfonyl-3-pentyloxirane.
| Compound Name | (2S,3R)-2-(4-methylphenyl)sulfonyl-3-pentyloxirane |
|---|---|
| PubChem CID | 15316045 |
| Molecular Formula | C14H20O3S |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | (2S,3R)-2-(4-methylphenyl)sulfonyl-3-pentyloxirane |
| SMILES | CCCCC[C@H]1O[C@H]1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C14H20O3S/c1-3-4-5-6-13-14(17-13)18(15,16)12-9-7-11(2)8-10-12/h7-10,13-14H,3-6H2,1-2H3/t13-,14+/m1/s1 |
| InChIKey | VRCXTRRDRSKPJH-KGLIPLIRSA-N |
| XLogP | 3.07 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|