C23H31NO4S2 — CID 10789691
4-methyl-N-[[(2R,3R)-3-octyloxiran-2-yl]-oxo-phenyl-λ6-sulfanylidene]benzenesulfonamide (PubChem CID 10789691) has the molecular formula C23H31NO4S2 and a molecular weight of 449.64 g/mol. Its IUPAC name is 4-methyl-N-[[(2R,3R)-3-octyloxiran-2-yl]-oxo-phenyl-λ6-sulfanylidene]benzenesulfonamide.
| Compound Name | 4-methyl-N-[[(2R,3R)-3-octyloxiran-2-yl]-oxo-phenyl-λ6-sulfanylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 10789691 |
| Molecular Formula | C23H31NO4S2 |
| Molecular Weight | 449.64 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | 4-methyl-N-[[(2R,3R)-3-octyloxiran-2-yl]-oxo-phenyl-λ6-sulfanylidene]benzenesulfonamide |
| SMILES | CCCCCCCC[C@H]1O[C@@H]1S(=O)(=NS(=O)(=O)c1ccc(C)cc1)c1ccccc1 |
| InChI | InChI=1S/C23H31NO4S2/c1-3-4-5-6-7-11-14-22-23(28-22)29(25,20-12-9-8-10-13-20)24-30(26,27)21-17-15-19(2)16-18-21/h8-10,12-13,15-18,22-23H,3-7,11,14H2,1-2H3/t22-,23-,29?/m1/s1 |
| InChIKey | AKRNTNNSSLISPU-JEVJGCHESA-N |
| XLogP | 5.69 |
| TPSA | 76.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.64 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|