C19H17NO3S2 — CID 12506494
4-methyl-N-[oxo(diphenyl)-λ6-sulfanylidene]benzenesulfonamide (PubChem CID 12506494) has the molecular formula C19H17NO3S2 and a molecular weight of 371.48 g/mol. Its IUPAC name is 4-methyl-N-[oxo(diphenyl)-λ6-sulfanylidene]benzenesulfonamide.
| Compound Name | 4-methyl-N-[oxo(diphenyl)-λ6-sulfanylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 12506494 |
| Molecular Formula | C19H17NO3S2 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | 4-methyl-N-[oxo(diphenyl)-λ6-sulfanylidene]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N=S(=O)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H17NO3S2/c1-16-12-14-19(15-13-16)25(22,23)20-24(21,17-8-4-2-5-9-17)18-10-6-3-7-11-18/h2-15H,1H3 |
| InChIKey | HCHTYDFAVLTULT-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 63.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |