C20H18FNO3S2 — CID 86328639
N-[[(R)-fluoro(phenyl)methyl]-oxo-phenyl-λ6-sulfanylidene]-4-methylbenzenesulfonamide (PubChem CID 86328639) has the molecular formula C20H18FNO3S2 and a molecular weight of 403.50 g/mol. Its IUPAC name is N-[[(R)-fluoro(phenyl)methyl]-oxo-phenyl-λ6-sulfanylidene]-4-methylbenzenesulfonamide.
| Compound Name | N-[[(R)-fluoro(phenyl)methyl]-oxo-phenyl-λ6-sulfanylidene]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 86328639 |
| Molecular Formula | C20H18FNO3S2 |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | N-[[(R)-fluoro(phenyl)methyl]-oxo-phenyl-λ6-sulfanylidene]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N=[S@](=O)(c2ccccc2)[C@@H](F)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H18FNO3S2/c1-16-12-14-19(15-13-16)27(24,25)22-26(23,18-10-6-3-7-11-18)20(21)17-8-4-2-5-9-17/h2-15,20H,1H3/t20-,26+/m1/s1 |
| InChIKey | ZAGQEXRRSCLLFW-IBVKSMDESA-N |
| XLogP | 4.88 |
| TPSA | 63.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |