C25H31NO3S2Si — CID 11799117
4-methyl-N-[oxo-phenyl-(2-phenyl-1-trimethylsilylpropyl)-λ6-sulfanylidene]benzenesulfonamide (PubChem CID 11799117) has the molecular formula C25H31NO3S2Si and a molecular weight of 485.75 g/mol. Its IUPAC name is 4-methyl-N-[oxo-phenyl-(2-phenyl-1-trimethylsilylpropyl)-λ6-sulfanylidene]benzenesulfonamide.
| Compound Name | 4-methyl-N-[oxo-phenyl-(2-phenyl-1-trimethylsilylpropyl)-λ6-sulfanylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 11799117 |
| Molecular Formula | C25H31NO3S2Si |
| Molecular Weight | 485.75 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | 4-methyl-N-[oxo-phenyl-(2-phenyl-1-trimethylsilylpropyl)-λ6-sulfanylidene]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N=S(=O)(c2ccccc2)C(C(C)c2ccccc2)[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C25H31NO3S2Si/c1-20-16-18-24(19-17-20)31(28,29)26-30(27,23-14-10-7-11-15-23)25(32(3,4)5)21(2)22-12-8-6-9-13-22/h6-19,21,25H,1-5H3 |
| InChIKey | PMOJBEZYLBVBKL-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 63.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.75 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|