C19H25NO6S3 — CID 10456929
[(2R)-3-methyl-1-[N-(4-methylphenyl)sulfonyl-S-phenylsulfonimidoyl]butan-2-yl] methanesulfonate (PubChem CID 10456929) has the molecular formula C19H25NO6S3 and a molecular weight of 459.61 g/mol. Its IUPAC name is [(2R)-3-methyl-1-[N-(4-methylphenyl)sulfonyl-S-phenylsulfonimidoyl]butan-2-yl] methanesulfonate.
| Compound Name | [(2R)-3-methyl-1-[N-(4-methylphenyl)sulfonyl-S-phenylsulfonimidoyl]butan-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 10456929 |
| Molecular Formula | C19H25NO6S3 |
| Molecular Weight | 459.61 g/mol |
| Exact Mass | 459.08 |
| IUPAC Name | [(2R)-3-methyl-1-[N-(4-methylphenyl)sulfonyl-S-phenylsulfonimidoyl]butan-2-yl] methanesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)N=S(=O)(C[C@H](OS(C)(=O)=O)C(C)C)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H25NO6S3/c1-15(2)19(26-27(4,21)22)14-28(23,17-8-6-5-7-9-17)20-29(24,25)18-12-10-16(3)11-13-18/h5-13,15,19H,14H2,1-4H3/t19-,28?/m0/s1 |
| InChIKey | LQBBEFGYDLOWCV-ZAFBDEJNSA-N |
| XLogP | 3.21 |
| TPSA | 106.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.61 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|