C25H35NO3S2 — CID 10766445
N-(2-cyclohexylhexyl-oxo-phenyl-lambda6-sulfanylidene)-4-methylbenzenesulfonamide (PubChem CID 10766445) has the molecular formula C25H35NO3S2 and a molecular weight of 461.69 g/mol. Its IUPAC name is N-(2-cyclohexylhexyl-oxo-phenyl-lambda6-sulfanylidene)-4-methylbenzenesulfonamide.
| Compound Name | N-(2-cyclohexylhexyl-oxo-phenyl-lambda6-sulfanylidene)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 10766445 |
| Molecular Formula | C25H35NO3S2 |
| Molecular Weight | 461.69 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | N-(2-cyclohexylhexyl-oxo-phenyl-lambda6-sulfanylidene)-4-methylbenzenesulfonamide |
| SMILES | CCCCC(CS(=O)(=NS(=O)(=O)c1ccc(C)cc1)c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C25H35NO3S2/c1-3-4-11-23(22-12-7-5-8-13-22)20-30(27,24-14-9-6-10-15-24)26-31(28,29)25-18-16-21(2)17-19-25/h6,9-10,14-19,22-23H,3-5,7-8,11-13,20H2,1-2H3 |
| InChIKey | URYTYQIMXHJBHC-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 63.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.69 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |