C21H25NO3S2 — CID 25038897
N-[[(E)-2-cyclohexylethenyl]-oxo-phenyl-λ6-sulfanylidene]-4-methylbenzenesulfonamide (PubChem CID 25038897) has the molecular formula C21H25NO3S2 and a molecular weight of 403.57 g/mol. Its IUPAC name is N-[[(E)-2-cyclohexylethenyl]-oxo-phenyl-λ6-sulfanylidene]-4-methylbenzenesulfonamide.
| Compound Name | N-[[(E)-2-cyclohexylethenyl]-oxo-phenyl-λ6-sulfanylidene]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 25038897 |
| Molecular Formula | C21H25NO3S2 |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | N-[[(E)-2-cyclohexylethenyl]-oxo-phenyl-λ6-sulfanylidene]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N=[S@](=O)(/C=C/C2CCCCC2)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H25NO3S2/c1-18-12-14-21(15-13-18)27(24,25)22-26(23,20-10-6-3-7-11-20)17-16-19-8-4-2-5-9-19/h3,6-7,10-17,19H,2,4-5,8-9H2,1H3/b17-16+/t26-/m0/s1 |
| InChIKey | MXIKBBGWAQYPTF-ZOGILVBSSA-N |
| XLogP | 5.30 |
| TPSA | 63.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |