C32H28N4O8S4 — CID 21240674
N-[(4E)-3,4-bis(benzenesulfonylimino)-6-[(4-methylphenyl)sulfonylamino]cyclohexa-1,5-dien-1-yl]-4-methylbenzenesulfonamide (PubChem CID 21240674) has the molecular formula C32H28N4O8S4 and a molecular weight of 724.86 g/mol. Its IUPAC name is N-[(4E)-3,4-bis(benzenesulfonylimino)-6-[(4-methylphenyl)sulfonylamino]cyclohexa-1,5-dien-1-yl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(4E)-3,4-bis(benzenesulfonylimino)-6-[(4-methylphenyl)sulfonylamino]cyclohexa-1,5-dien-1-yl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 21240674 |
| Molecular Formula | C32H28N4O8S4 |
| Molecular Weight | 724.86 g/mol |
| Exact Mass | 724.08 |
| IUPAC Name | N-[(4E)-3,4-bis(benzenesulfonylimino)-6-[(4-methylphenyl)sulfonylamino]cyclohexa-1,5-dien-1-yl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC2=CC(=NS(=O)(=O)c3ccccc3)/C(=N/S(=O)(=O)c3ccccc3)C=C2NS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C32H28N4O8S4/c1-23-13-17-27(18-14-23)47(41,42)35-31-21-29(33-45(37,38)25-9-5-3-6-10-25)30(34-46(39,40)26-11-7-4-8-12-26)22-32(31)36-48(43,44)28-19-15-24(2)16-20-28/h3-22,35-36H,1-2H3/b33-29+,34-30? |
| InChIKey | ZXDSXNIQVVTOEC-SKVCKMSESA-N |
| XLogP | 4.00 |
| TPSA | 185.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.86 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|