C24H19NO5S2 — CID 561333
4-methyl-N-[3-(4-methylphenyl)sulfonyl-4-oxonaphthalen-1-ylidene]benzenesulfonamide (PubChem CID 561333) has the molecular formula C24H19NO5S2 and a molecular weight of 465.55 g/mol. Its IUPAC name is 4-methyl-N-[3-(4-methylphenyl)sulfonyl-4-oxonaphthalen-1-ylidene]benzenesulfonamide.
| Compound Name | 4-methyl-N-[3-(4-methylphenyl)sulfonyl-4-oxonaphthalen-1-ylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 561333 |
| Molecular Formula | C24H19NO5S2 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.07 |
| IUPAC Name | 4-methyl-N-[3-(4-methylphenyl)sulfonyl-4-oxonaphthalen-1-ylidene]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N=C2C=C(S(=O)(=O)c3ccc(C)cc3)C(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C24H19NO5S2/c1-16-7-11-18(12-8-16)31(27,28)23-15-22(20-5-3-4-6-21(20)24(23)26)25-32(29,30)19-13-9-17(2)10-14-19/h3-15H,1-2H3 |
| InChIKey | INGPJNBXKIVOSX-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 97.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|