C16H12N2O3S — CID 85435433
4-methyl-N-(5-oxoquinolin-8-ylidene)benzenesulfonamide (PubChem CID 85435433) has the molecular formula C16H12N2O3S and a molecular weight of 312.35 g/mol. Its IUPAC name is 4-methyl-N-(5-oxoquinolin-8-ylidene)benzenesulfonamide.
| Compound Name | 4-methyl-N-(5-oxoquinolin-8-ylidene)benzenesulfonamide |
|---|---|
| PubChem CID | 85435433 |
| Molecular Formula | C16H12N2O3S |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | 4-methyl-N-(5-oxoquinolin-8-ylidene)benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N=C2C=CC(=O)c3cccnc32)cc1 |
| InChI | InChI=1S/C16H12N2O3S/c1-11-4-6-12(7-5-11)22(20,21)18-14-8-9-15(19)13-3-2-10-17-16(13)14/h2-10H,1H3 |
| InChIKey | MIBZJDCYIFVCFX-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 76.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|