C27H18N2O5S — CID 98158792
4-methyl-N-[4-oxo-3-[(E)-(1-oxonaphthalen-2-ylidene)amino]oxynaphthalen-1-ylidene]benzenesulfonamide (PubChem CID 98158792) has the molecular formula C27H18N2O5S and a molecular weight of 482.52 g/mol. Its IUPAC name is 4-methyl-N-[4-oxo-3-[(E)-(1-oxonaphthalen-2-ylidene)amino]oxynaphthalen-1-ylidene]benzenesulfonamide.
| Compound Name | 4-methyl-N-[4-oxo-3-[(E)-(1-oxonaphthalen-2-ylidene)amino]oxynaphthalen-1-ylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 98158792 |
| Molecular Formula | C27H18N2O5S |
| Molecular Weight | 482.52 g/mol |
| Exact Mass | 482.09 |
| IUPAC Name | 4-methyl-N-[4-oxo-3-[(E)-(1-oxonaphthalen-2-ylidene)amino]oxynaphthalen-1-ylidene]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N=C2C=C(O/N=C3\C=Cc4ccccc4C3=O)C(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C27H18N2O5S/c1-17-10-13-19(14-11-17)35(32,33)29-24-16-25(27(31)22-9-5-4-8-21(22)24)34-28-23-15-12-18-6-2-3-7-20(18)26(23)30/h2-16H,1H3/b28-23+,29-24? |
| InChIKey | WHXHHMWXDKDSPC-IINOXRHCSA-N |
| XLogP | 4.54 |
| TPSA | 102.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.52 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|