C25H19NO7S3 — CID 3400464
N-[3,5-bis(benzenesulfonyl)-4-oxocyclohexa-2,5-dien-1-ylidene]-4-methylbenzenesulfonamide (PubChem CID 3400464) has the molecular formula C25H19NO7S3 and a molecular weight of 541.63 g/mol. Its IUPAC name is N-[3,5-bis(benzenesulfonyl)-4-oxocyclohexa-2,5-dien-1-ylidene]-4-methylbenzenesulfonamide.
| Compound Name | N-[3,5-bis(benzenesulfonyl)-4-oxocyclohexa-2,5-dien-1-ylidene]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 3400464 |
| Molecular Formula | C25H19NO7S3 |
| Molecular Weight | 541.63 g/mol |
| Exact Mass | 541.03 |
| IUPAC Name | N-[3,5-bis(benzenesulfonyl)-4-oxocyclohexa-2,5-dien-1-ylidene]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N=C2C=C(S(=O)(=O)c3ccccc3)C(=O)C(S(=O)(=O)c3ccccc3)=C2)cc1 |
| InChI | InChI=1S/C25H19NO7S3/c1-18-12-14-22(15-13-18)36(32,33)26-19-16-23(34(28,29)20-8-4-2-5-9-20)25(27)24(17-19)35(30,31)21-10-6-3-7-11-21/h2-17H,1H3 |
| InChIKey | PYWBXUCGRUKYMN-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 131.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.63 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|