C19H15NO3S — CID 3457319
2-(4-methylphenyl)sulfonyl-4-phenyliminocyclohexa-2,5-dien-1-one (PubChem CID 3457319) has the molecular formula C19H15NO3S and a molecular weight of 337.40 g/mol. Its IUPAC name is 2-(4-methylphenyl)sulfonyl-4-phenyliminocyclohexa-2,5-dien-1-one.
| Compound Name | 2-(4-methylphenyl)sulfonyl-4-phenyliminocyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 3457319 |
| Molecular Formula | C19H15NO3S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | 2-(4-methylphenyl)sulfonyl-4-phenyliminocyclohexa-2,5-dien-1-one |
| SMILES | Cc1ccc(S(=O)(=O)C2=C/C(=N/c3ccccc3)C=CC2=O)cc1 |
| InChI | InChI=1S/C19H15NO3S/c1-14-7-10-17(11-8-14)24(22,23)19-13-16(9-12-18(19)21)20-15-5-3-2-4-6-15/h2-13H,1H3/b20-16+ |
| InChIKey | MPTQAEVZWDYWNG-CAPFRKAQSA-N |
| XLogP | 3.56 |
| TPSA | 63.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|