C16H21NO — CID 91171720
ethane;4-phenyliminocyclohexa-2,5-dien-1-one (PubChem CID 91171720) has the molecular formula C16H21NO and a molecular weight of 243.35 g/mol. Its IUPAC name is ethane;4-phenyliminocyclohexa-2,5-dien-1-one.
| Compound Name | ethane;4-phenyliminocyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 91171720 |
| Molecular Formula | C16H21NO |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | ethane;4-phenyliminocyclohexa-2,5-dien-1-one |
| SMILES | CC.CC.O=C1C=CC(=Nc2ccccc2)C=C1 |
| InChI | InChI=1S/C12H9NO.2C2H6/c14-12-8-6-11(7-9-12)13-10-4-2-1-3-5-10;2*1-2/h1-9H;2*1-2H3 |
| InChIKey | MMTQXJUOBDLCKF-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|