C12H10N+ — CID 53401250
N-phenylcyclohexa-2,5-dien-1-imine (PubChem CID 53401250) has the molecular formula C12H10N+ and a molecular weight of 168.22 g/mol. Its IUPAC name is N-phenylcyclohexa-2,5-dien-1-imine.
| Compound Name | N-phenylcyclohexa-2,5-dien-1-imine |
|---|---|
| PubChem CID | 53401250 |
| Molecular Formula | C12H10N+ |
| Molecular Weight | 168.22 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | N-phenylcyclohexa-2,5-dien-1-imine |
| SMILES | C1=CC(=Nc2ccccc2)C=C[CH+]1 |
| InChI | InChI=1S/C12H10N/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1-10H/q+1 |
| InChIKey | GNKRCJRRDFUGIJ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.22 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|