C25H20N4 — CID 20673086
1-N-methyl-4-N-[4-[(4-phenyliminocyclohexa-2,5-dien-1-ylidene)amino]phenyl]cyclohexa-2,5-diene-1,4-diimine (PubChem CID 20673086) has the molecular formula C25H20N4 and a molecular weight of 376.46 g/mol. Its IUPAC name is 1-N-methyl-4-N-[4-[(4-phenyliminocyclohexa-2,5-dien-1-ylidene)amino]phenyl]cyclohexa-2,5-diene-1,4-diimine.
| Compound Name | 1-N-methyl-4-N-[4-[(4-phenyliminocyclohexa-2,5-dien-1-ylidene)amino]phenyl]cyclohexa-2,5-diene-1,4-diimine |
|---|---|
| PubChem CID | 20673086 |
| Molecular Formula | C25H20N4 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 1-N-methyl-4-N-[4-[(4-phenyliminocyclohexa-2,5-dien-1-ylidene)amino]phenyl]cyclohexa-2,5-diene-1,4-diimine |
| SMILES | CN=C1C=CC(=Nc2ccc(N=C3C=CC(=Nc4ccccc4)C=C3)cc2)C=C1 |
| InChI | InChI=1S/C25H20N4/c1-26-19-7-9-21(10-8-19)28-23-15-17-25(18-16-23)29-24-13-11-22(12-14-24)27-20-5-3-2-4-6-20/h2-18H,1H3/b26-19-,27-22-,28-21+,29-24+ |
| InChIKey | PLRUSPAUGVYVIF-WJENHCHASA-N |
| XLogP | 5.93 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|