About ethane;methyl-[4-[4-(methyldiazenyl)phenyl]phenyl]diazene;methyl(phenyl)diazene
ethane;methyl-[4-[4-(methyldiazenyl)phenyl]phenyl]diazene;methyl(phenyl)diazene (PubChem CID 158007531) has the molecular formula C27H40N6
and a molecular weight of 448.66 g/mol. Its IUPAC name is ethane;methyl-[4-[4-(methyldiazenyl)phenyl]phenyl]diazene;methyl(phenyl)diazene.
Molecular Properties
| Compound Name | ethane;methyl-[4-[4-(methyldiazenyl)phenyl]phenyl]diazene;methyl(phenyl)diazene |
| PubChem CID | 158007531 |
| Molecular Formula | C27H40N6 |
| Molecular Weight | 448.66 g/mol |
| Exact Mass | 448.33 |
| IUPAC Name | ethane;methyl-[4-[4-(methyldiazenyl)phenyl]phenyl]diazene;methyl(phenyl)diazene |
| SMILES | C/N=N/c1ccc(-c2ccc(/N=N/C)cc2)cc1.C/N=N/c1ccccc1.CC.CC.CC |
| InChI | InChI=1S/C14H14N4.C7H8N2.3C2H6/c1-15-17-13-7-3-11(4-8-13)12-5-9-14(10-6-12)18-16-2;1-8-9-7-5-3-2-4-6-7;3*1-2/h3-10H,1-2H3;2-6H,1H3;3*1-2H3/b17-15+,18-16+;9-8+;;; |
| InChIKey | FEMALWQHPCPLCC-CKXXOOJMSA-N |
| XLogP | 10.26 |
| TPSA | 74.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 448.66 |
| LogP ≤ 5 | 10.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze ethane;methyl-[4-[4-(methyldiazenyl)phenyl]phenyl]diazene;methyl(phenyl)diazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methyl-[4-[4-(methyldiazenyl)phenyl]phenyl]diazene;methyl(phenyl)diazene?
The IUPAC name of ethane;methyl-[4-[4-(methyldiazenyl)phenyl]phenyl]diazene;methyl(phenyl)diazene (CID 158007531) is ethane;methyl-[4-[4-(methyldiazenyl)phenyl]phenyl]diazene;methyl(phenyl)diazene.
What is the SMILES notation for ethane;methyl-[4-[4-(methyldiazenyl)phenyl]phenyl]diazene;methyl(phenyl)diazene?
The canonical SMILES for ethane;methyl-[4-[4-(methyldiazenyl)phenyl]phenyl]diazene;methyl(phenyl)diazene is C/N=N/c1ccc(-c2ccc(/N=N/C)cc2)cc1.C/N=N/c1ccccc1.CC.CC.CC.
What is the InChIKey of ethane;methyl-[4-[4-(methyldiazenyl)phenyl]phenyl]diazene;methyl(phenyl)diazene?
The InChIKey is FEMALWQHPCPLCC-CKXXOOJMSA-N. The full InChI is InChI=1S/C14H14N4.C7H8N2.3C2H6/c1-15-17-13-7-3-11(4-8-13)12-5-9-14(10-6-12)18-16-2;1-8-9-7-5-3-2-4-6-7;3*1-2/h3-10H,1-2H3;2-6H,1H3;3*1-2H3/b17-15+,18-16+;9-8+;;;.
What are the key properties of ethane;methyl-[4-[4-(methyldiazenyl)phenyl]phenyl]diazene;methyl(phenyl)diazene?
ethane;methyl-[4-[4-(methyldiazenyl)phenyl]phenyl]diazene;methyl(phenyl)diazene has a molecular weight of 448.66 g/mol, XLogP of 10.26, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methyl-[4-[4-(methyldiazenyl)phenyl]phenyl]diazene;methyl(phenyl)diazene is sourced from PubChem (CID 158007531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).