C20H18N2 — CID 70648511
4-[(4-methyliminocyclohexa-2,5-dien-1-ylidene)-phenylmethyl]aniline (PubChem CID 70648511) has the molecular formula C20H18N2 and a molecular weight of 286.38 g/mol. Its IUPAC name is 4-[(4-methyliminocyclohexa-2,5-dien-1-ylidene)-phenylmethyl]aniline.
| Compound Name | 4-[(4-methyliminocyclohexa-2,5-dien-1-ylidene)-phenylmethyl]aniline |
|---|---|
| PubChem CID | 70648511 |
| Molecular Formula | C20H18N2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 4-[(4-methyliminocyclohexa-2,5-dien-1-ylidene)-phenylmethyl]aniline |
| SMILES | CN=C1C=CC(=C(c2ccccc2)c2ccc(N)cc2)C=C1 |
| InChI | InChI=1S/C20H18N2/c1-22-19-13-9-17(10-14-19)20(15-5-3-2-4-6-15)16-7-11-18(21)12-8-16/h2-14H,21H2,1H3/b20-17-,22-19+ |
| InChIKey | GOGDHFKUBUFBDC-NEVXJGNOSA-N |
| XLogP | 4.27 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|