C31H27N — CID 20686379
N-methyl-4-[(2E,4E)-5-(4-methylphenyl)-1,5-diphenylpenta-2,4-dienylidene]cyclohexa-2,5-dien-1-imine (PubChem CID 20686379) has the molecular formula C31H27N and a molecular weight of 413.56 g/mol. Its IUPAC name is N-methyl-4-[(2E,4E)-5-(4-methylphenyl)-1,5-diphenylpenta-2,4-dienylidene]cyclohexa-2,5-dien-1-imine.
| Compound Name | N-methyl-4-[(2E,4E)-5-(4-methylphenyl)-1,5-diphenylpenta-2,4-dienylidene]cyclohexa-2,5-dien-1-imine |
|---|---|
| PubChem CID | 20686379 |
| Molecular Formula | C31H27N |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | N-methyl-4-[(2E,4E)-5-(4-methylphenyl)-1,5-diphenylpenta-2,4-dienylidene]cyclohexa-2,5-dien-1-imine |
| SMILES | CN=C1C=CC(=C(/C=C/C=C(\c2ccccc2)c2ccc(C)cc2)c2ccccc2)C=C1 |
| InChI | InChI=1S/C31H27N/c1-24-16-18-27(19-17-24)30(25-10-5-3-6-11-25)14-9-15-31(26-12-7-4-8-13-26)28-20-22-29(32-2)23-21-28/h3-23H,1-2H3/b15-9+,30-14+,31-28-,32-29+ |
| InChIKey | LURLRKVNTZEIQA-ICABXICTSA-N |
| XLogP | 7.63 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|