C36H38NO+ — CID 58427612
diethyl-[4-[1-(4-methoxyphenyl)-5,5-bis(4-methylphenyl)penta-2,4-dienylidene]cyclohexa-2,5-dien-1-ylidene]azanium (PubChem CID 58427612) has the molecular formula C36H38NO+ and a molecular weight of 500.71 g/mol. Its IUPAC name is diethyl-[4-[1-(4-methoxyphenyl)-5,5-bis(4-methylphenyl)penta-2,4-dienylidene]cyclohexa-2,5-dien-1-ylidene]azanium.
| Compound Name | diethyl-[4-[1-(4-methoxyphenyl)-5,5-bis(4-methylphenyl)penta-2,4-dienylidene]cyclohexa-2,5-dien-1-ylidene]azanium |
|---|---|
| PubChem CID | 58427612 |
| Molecular Formula | C36H38NO+ |
| Molecular Weight | 500.71 g/mol |
| Exact Mass | 500.29 |
| IUPAC Name | diethyl-[4-[1-(4-methoxyphenyl)-5,5-bis(4-methylphenyl)penta-2,4-dienylidene]cyclohexa-2,5-dien-1-ylidene]azanium |
| SMILES | CC[N+](CC)=C1C=CC(=C(C=CC=C(c2ccc(C)cc2)c2ccc(C)cc2)c2ccc(OC)cc2)C=C1 |
| InChI | InChI=1S/C36H38NO/c1-6-37(7-2)33-23-19-31(20-24-33)36(32-21-25-34(38-5)26-22-32)10-8-9-35(29-15-11-27(3)12-16-29)30-17-13-28(4)14-18-30/h8-26H,6-7H2,1-5H3/q+1 |
| InChIKey | TUBJRZADBDQTRT-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.71 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|