C47H63N4+ — CID 89097995
[4-[1,5-bis[4-(diethylamino)phenyl]-5-[4-[ethyl(propyl)amino]phenyl]penta-2,4-dienylidene]cyclohexa-2,5-dien-1-ylidene]-ethyl-propylazanium (PubChem CID 89097995) has the molecular formula C47H63N4+ and a molecular weight of 684.05 g/mol. Its IUPAC name is [4-[1,5-bis[4-(diethylamino)phenyl]-5-[4-[ethyl(propyl)amino]phenyl]penta-2,4-dienylidene]cyclohexa-2,5-dien-1-ylidene]-ethyl-propylazanium.
| Compound Name | [4-[1,5-bis[4-(diethylamino)phenyl]-5-[4-[ethyl(propyl)amino]phenyl]penta-2,4-dienylidene]cyclohexa-2,5-dien-1-ylidene]-ethyl-propylazanium |
|---|---|
| PubChem CID | 89097995 |
| Molecular Formula | C47H63N4+ |
| Molecular Weight | 684.05 g/mol |
| Exact Mass | 683.50 |
| IUPAC Name | [4-[1,5-bis[4-(diethylamino)phenyl]-5-[4-[ethyl(propyl)amino]phenyl]penta-2,4-dienylidene]cyclohexa-2,5-dien-1-ylidene]-ethyl-propylazanium |
| SMILES | CCCN(CC)c1ccc(C(=CC=CC(=C2C=CC(=[N+](CC)CCC)C=C2)c2ccc(N(CC)CC)cc2)c2ccc(N(CC)CC)cc2)cc1 |
| InChI | InChI=1S/C47H63N4/c1-9-36-50(15-7)44-32-24-40(25-33-44)46(38-20-28-42(29-21-38)48(11-3)12-4)18-17-19-47(39-22-30-43(31-23-39)49(13-5)14-6)41-26-34-45(35-27-41)51(16-8)37-10-2/h17-35H,9-16,36-37H2,1-8H3/q+1 |
| InChIKey | ZSVOWZJMTYQIMG-UHFFFAOYSA-N |
| XLogP | 11.07 |
| TPSA | 12.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.05 |
| LogP ≤ 5 | 11.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|