C39H47N4+ — CID 87900673
[4-[(2E,4E)-5-(4-aminophenyl)-1,5-bis[4-(diethylamino)phenyl]penta-2,4-dienylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium (PubChem CID 87900673) has the molecular formula C39H47N4+ and a molecular weight of 571.83 g/mol. Its IUPAC name is [4-[(2E,4E)-5-(4-aminophenyl)-1,5-bis[4-(diethylamino)phenyl]penta-2,4-dienylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium.
| Compound Name | [4-[(2E,4E)-5-(4-aminophenyl)-1,5-bis[4-(diethylamino)phenyl]penta-2,4-dienylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 87900673 |
| Molecular Formula | C39H47N4+ |
| Molecular Weight | 571.83 g/mol |
| Exact Mass | 571.38 |
| IUPAC Name | [4-[(2E,4E)-5-(4-aminophenyl)-1,5-bis[4-(diethylamino)phenyl]penta-2,4-dienylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium |
| SMILES | CCN(CC)c1ccc(C(/C=C/C=C(\c2ccc(N)cc2)c2ccc(N(CC)CC)cc2)=C2C=CC(=[N+](C)C)C=C2)cc1 |
| InChI | InChI=1S/C39H46N4/c1-7-42(8-2)36-26-18-32(19-27-36)38(30-14-22-34(40)23-15-30)12-11-13-39(31-16-24-35(25-17-31)41(5)6)33-20-28-37(29-21-33)43(9-3)10-4/h11-29,40H,7-10H2,1-6H3/p+1 |
| InChIKey | HFRQWUGQFZJSLB-UHFFFAOYSA-O |
| XLogP | 8.24 |
| TPSA | 35.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.83 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|