C40H48N4+2 — CID 15400348
[4-[(2E,4E)-1,6-bis[4-(dimethylamino)phenyl]-6-(4-dimethylazaniumylidenecyclohexa-2,5-dien-1-ylidene)-3,4-dimethylhexa-2,4-dienylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium (PubChem CID 15400348) has the molecular formula C40H48N4+2 and a molecular weight of 584.85 g/mol. Its IUPAC name is [4-[(2E,4E)-1,6-bis[4-(dimethylamino)phenyl]-6-(4-dimethylazaniumylidenecyclohexa-2,5-dien-1-ylidene)-3,4-dimethylhexa-2,4-dienylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium.
| Compound Name | [4-[(2E,4E)-1,6-bis[4-(dimethylamino)phenyl]-6-(4-dimethylazaniumylidenecyclohexa-2,5-dien-1-ylidene)-3,4-dimethylhexa-2,4-dienylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 15400348 |
| Molecular Formula | C40H48N4+2 |
| Molecular Weight | 584.85 g/mol |
| Exact Mass | 584.39 |
| IUPAC Name | [4-[(2E,4E)-1,6-bis[4-(dimethylamino)phenyl]-6-(4-dimethylazaniumylidenecyclohexa-2,5-dien-1-ylidene)-3,4-dimethylhexa-2,4-dienylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium |
| SMILES | CC(=C\C(=C1C=CC(=[N+](C)C)C=C1)c1ccc(N(C)C)cc1)/C(C)=C/C(=C1C=CC(=[N+](C)C)C=C1)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C40H48N4/c1-29(27-39(31-11-19-35(20-12-31)41(3)4)32-13-21-36(22-14-32)42(5)6)30(2)28-40(33-15-23-37(24-16-33)43(7)8)34-17-25-38(26-18-34)44(9)10/h11-28H,1-10H3/q+2/b29-27+,30-28+ |
| InChIKey | BIFOLPJKENGKNQ-QAVVBOBSSA-N |
| XLogP | 7.60 |
| TPSA | 12.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.85 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|