C39H53ClN3+ — CID 22952634
[4-[(2E,4E)-3-chloro-5-[4-(dihexylamino)phenyl]-1-[4-(dimethylamino)phenyl]penta-2,4-dienylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium (PubChem CID 22952634) has the molecular formula C39H53ClN3+ and a molecular weight of 599.33 g/mol. Its IUPAC name is [4-[(2E,4E)-3-chloro-5-[4-(dihexylamino)phenyl]-1-[4-(dimethylamino)phenyl]penta-2,4-dienylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium.
| Compound Name | [4-[(2E,4E)-3-chloro-5-[4-(dihexylamino)phenyl]-1-[4-(dimethylamino)phenyl]penta-2,4-dienylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 22952634 |
| Molecular Formula | C39H53ClN3+ |
| Molecular Weight | 599.33 g/mol |
| Exact Mass | 598.39 |
| IUPAC Name | [4-[(2E,4E)-3-chloro-5-[4-(dihexylamino)phenyl]-1-[4-(dimethylamino)phenyl]penta-2,4-dienylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium |
| SMILES | CCCCCCN(CCCCCC)c1ccc(/C=C/C(Cl)=C\C(=C2C=CC(=[N+](C)C)C=C2)c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C39H53ClN3/c1-7-9-11-13-29-43(30-14-12-10-8-2)38-23-16-32(17-24-38)15-22-35(40)31-39(33-18-25-36(26-19-33)41(3)4)34-20-27-37(28-21-34)42(5)6/h15-28,31H,7-14,29-30H2,1-6H3/q+1 |
| InChIKey | OWLSZZNPYFSYJT-UHFFFAOYSA-N |
| XLogP | 10.15 |
| TPSA | 9.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.33 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|