C27H29N2+ — CID 22952644
[4-[(2Z,4E)-5-[4-(dimethylamino)phenyl]-3-phenylpenta-2,4-dienylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium (PubChem CID 22952644) has the molecular formula C27H29N2+ and a molecular weight of 381.54 g/mol. Its IUPAC name is [4-[(2Z,4E)-5-[4-(dimethylamino)phenyl]-3-phenylpenta-2,4-dienylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium.
| Compound Name | [4-[(2Z,4E)-5-[4-(dimethylamino)phenyl]-3-phenylpenta-2,4-dienylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 22952644 |
| Molecular Formula | C27H29N2+ |
| Molecular Weight | 381.54 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | [4-[(2Z,4E)-5-[4-(dimethylamino)phenyl]-3-phenylpenta-2,4-dienylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium |
| SMILES | CN(C)c1ccc(/C=C/C(=C/C=C2C=CC(=[N+](C)C)C=C2)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H29N2/c1-28(2)26-18-12-22(13-19-26)10-16-25(24-8-6-5-7-9-24)17-11-23-14-20-27(21-15-23)29(3)4/h5-21H,1-4H3/q+1 |
| InChIKey | JKMHIEMIHVWHFT-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.54 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|