C28H29N2O2- — CID 88939437
2-[(1E,3Z)-1-[4-(dimethylamino)phenyl]-5-[4-[methanidyl(methyl)amino]cyclohexa-2,5-dien-1-ylidene]penta-1,3-dien-3-yl]benzoic acid (PubChem CID 88939437) has the molecular formula C28H29N2O2- and a molecular weight of 425.55 g/mol. Its IUPAC name is 2-[(1E,3Z)-1-[4-(dimethylamino)phenyl]-5-[4-[methanidyl(methyl)amino]cyclohexa-2,5-dien-1-ylidene]penta-1,3-dien-3-yl]benzoic acid.
| Compound Name | 2-[(1E,3Z)-1-[4-(dimethylamino)phenyl]-5-[4-[methanidyl(methyl)amino]cyclohexa-2,5-dien-1-ylidene]penta-1,3-dien-3-yl]benzoic acid |
|---|---|
| PubChem CID | 88939437 |
| Molecular Formula | C28H29N2O2- |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | 2-[(1E,3Z)-1-[4-(dimethylamino)phenyl]-5-[4-[methanidyl(methyl)amino]cyclohexa-2,5-dien-1-ylidene]penta-1,3-dien-3-yl]benzoic acid |
| SMILES | [CH2-]N(C)C1C=CC(=C/C=C(/C=C/c2ccc(N(C)C)cc2)c2ccccc2C(=O)O)C=C1 |
| InChI | InChI=1S/C28H29N2O2/c1-29(2)24-17-11-21(12-18-24)9-15-23(26-7-5-6-8-27(26)28(31)32)16-10-22-13-19-25(20-14-22)30(3)4/h5-20,24H,1H2,2-4H3,(H,31,32)/q-1/b16-10+,21-9-,23-15- |
| InChIKey | FYHMZYTUDNAKCO-JIAWDQKCSA-N |
| XLogP | 5.69 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|